C11H19NO3S2 — CID 110852968
N-(1,1-dioxothiolan-3-yl)-N-methylthiane-3-carboxamide (PubChem CID 110852968) has the molecular formula C11H19NO3S2 and a molecular weight of 277.41 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methylthiane-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methylthiane-3-carboxamide |
|---|---|
| PubChem CID | 110852968 |
| Molecular Formula | C11H19NO3S2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methylthiane-3-carboxamide |
| SMILES | CN(C(=O)C1CCCSC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H19NO3S2/c1-12(10-4-6-17(14,15)8-10)11(13)9-3-2-5-16-7-9/h9-10H,2-8H2,1H3 |
| InChIKey | VFZIAXTXCJDPIO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |