C13H17N3OS — CID 110855502
N-cycloheptylimidazo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 110855502) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is N-cycloheptylimidazo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N-cycloheptylimidazo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 110855502 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-cycloheptylimidazo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | O=C(NC1CCCCCC1)c1csc2nccn12 |
| InChI | InChI=1S/C13H17N3OS/c17-12(15-10-5-3-1-2-4-6-10)11-9-18-13-14-7-8-16(11)13/h7-10H,1-6H2,(H,15,17) |
| InChIKey | WVJLGNDUKPLFOX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |