C19H19N5O — CID 110862212
N-(4-piperidin-1-ylphenyl)pyrido[2,3-b]pyrazine-7-carboxamide (PubChem CID 110862212) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is N-(4-piperidin-1-ylphenyl)pyrido[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-(4-piperidin-1-ylphenyl)pyrido[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 110862212 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | N-(4-piperidin-1-ylphenyl)pyrido[2,3-b]pyrazine-7-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)c1cnc2nccnc2c1 |
| InChI | InChI=1S/C19H19N5O/c25-19(14-12-17-18(22-13-14)21-9-8-20-17)23-15-4-6-16(7-5-15)24-10-2-1-3-11-24/h4-9,12-13H,1-3,10-11H2,(H,23,25) |
| InChIKey | RGDZWSYRHIRDKZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|