C14H13N3O2 — CID 110865435
7-methyl-N-(5-methyl-1,2-oxazol-3-yl)-1H-indole-2-carboxamide (PubChem CID 110865435) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 7-methyl-N-(5-methyl-1,2-oxazol-3-yl)-1H-indole-2-carboxamide.
| Compound Name | 7-methyl-N-(5-methyl-1,2-oxazol-3-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 110865435 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 7-methyl-N-(5-methyl-1,2-oxazol-3-yl)-1H-indole-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc3cccc(C)c3[nH]2)no1 |
| InChI | InChI=1S/C14H13N3O2/c1-8-4-3-5-10-7-11(15-13(8)10)14(18)16-12-6-9(2)19-17-12/h3-7,15H,1-2H3,(H,16,17,18) |
| InChIKey | MUZIOHGUKLJECB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |