About ethyl (5S)-3-butyl-8-oxo-6,7-dihydro-5H-indolizine-5-carboxylate
ethyl (5S)-3-butyl-8-oxo-6,7-dihydro-5H-indolizine-5-carboxylate (PubChem CID 11086602) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is ethyl (5S)-3-butyl-8-oxo-6,7-dihydro-5H-indolizine-5-carboxylate.
Molecular Properties
| Compound Name | ethyl (5S)-3-butyl-8-oxo-6,7-dihydro-5H-indolizine-5-carboxylate |
| PubChem CID | 11086602 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | ethyl (5S)-3-butyl-8-oxo-6,7-dihydro-5H-indolizine-5-carboxylate |
| SMILES | CCCCc1ccc2n1[C@H](C(=O)OCC)CCC2=O |
| InChI | InChI=1S/C15H21NO3/c1-3-5-6-11-7-8-12-14(17)10-9-13(16(11)12)15(18)19-4-2/h7-8,13H,3-6,9-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | IQNVHKZEOVHMAP-ZDUSSCGKSA-N |
| XLogP | 2.91 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (5S)-3-butyl-8-oxo-6,7-dihydro-5H-indolizine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (5S)-3-butyl-8-oxo-6,7-dihydro-5H-indolizine-5-carboxylate?
The IUPAC name of ethyl (5S)-3-butyl-8-oxo-6,7-dihydro-5H-indolizine-5-carboxylate (CID 11086602) is ethyl (5S)-3-butyl-8-oxo-6,7-dihydro-5H-indolizine-5-carboxylate.
What is the SMILES notation for ethyl (5S)-3-butyl-8-oxo-6,7-dihydro-5H-indolizine-5-carboxylate?
The canonical SMILES for ethyl (5S)-3-butyl-8-oxo-6,7-dihydro-5H-indolizine-5-carboxylate is CCCCc1ccc2n1[C@H](C(=O)OCC)CCC2=O.
What is the InChIKey of ethyl (5S)-3-butyl-8-oxo-6,7-dihydro-5H-indolizine-5-carboxylate?
The InChIKey is IQNVHKZEOVHMAP-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H21NO3/c1-3-5-6-11-7-8-12-14(17)10-9-13(16(11)12)15(18)19-4-2/h7-8,13H,3-6,9-10H2,1-2H3/t13-/m0/s1.
What are the key properties of ethyl (5S)-3-butyl-8-oxo-6,7-dihydro-5H-indolizine-5-carboxylate?
ethyl (5S)-3-butyl-8-oxo-6,7-dihydro-5H-indolizine-5-carboxylate has a molecular weight of 263.34 g/mol, XLogP of 2.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (5S)-3-butyl-8-oxo-6,7-dihydro-5H-indolizine-5-carboxylate is sourced from PubChem (CID 11086602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).