About 3-O-ethyl 8-O-methyl (3S)-7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3,8-dicarboxylate
3-O-ethyl 8-O-methyl (3S)-7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3,8-dicarboxylate (PubChem CID 118122220) has the molecular formula C13H15NO6
and a molecular weight of 281.26 g/mol. Its IUPAC name is 3-O-ethyl 8-O-methyl (3S)-7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3,8-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-ethyl 8-O-methyl (3S)-7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3,8-dicarboxylate |
| PubChem CID | 118122220 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 3-O-ethyl 8-O-methyl (3S)-7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3,8-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CCc2c(C(=O)OC)c(O)cc(=O)n21 |
| InChI | InChI=1S/C13H15NO6/c1-3-20-12(17)8-5-4-7-11(13(18)19-2)9(15)6-10(16)14(7)8/h6,8,15H,3-5H2,1-2H3/t8-/m0/s1 |
| InChIKey | FOAKEOPDNAGJFH-QMMMGPOBSA-N |
| XLogP | 0.39 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-O-ethyl 8-O-methyl (3S)-7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-ethyl 8-O-methyl (3S)-7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3,8-dicarboxylate?
The IUPAC name of 3-O-ethyl 8-O-methyl (3S)-7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3,8-dicarboxylate (CID 118122220) is 3-O-ethyl 8-O-methyl (3S)-7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3,8-dicarboxylate.
What is the SMILES notation for 3-O-ethyl 8-O-methyl (3S)-7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3,8-dicarboxylate?
The canonical SMILES for 3-O-ethyl 8-O-methyl (3S)-7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3,8-dicarboxylate is CCOC(=O)[C@@H]1CCc2c(C(=O)OC)c(O)cc(=O)n21.
What is the InChIKey of 3-O-ethyl 8-O-methyl (3S)-7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3,8-dicarboxylate?
The InChIKey is FOAKEOPDNAGJFH-QMMMGPOBSA-N. The full InChI is InChI=1S/C13H15NO6/c1-3-20-12(17)8-5-4-7-11(13(18)19-2)9(15)6-10(16)14(7)8/h6,8,15H,3-5H2,1-2H3/t8-/m0/s1.
What are the key properties of 3-O-ethyl 8-O-methyl (3S)-7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3,8-dicarboxylate?
3-O-ethyl 8-O-methyl (3S)-7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3,8-dicarboxylate has a molecular weight of 281.26 g/mol, XLogP of 0.39, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-ethyl 8-O-methyl (3S)-7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3,8-dicarboxylate is sourced from PubChem (CID 118122220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).