C7H8N4O2S — CID 110868117
N-(1H-pyrazolo[5,4-b]pyridin-3-yl)methanesulfonamide (PubChem CID 110868117) has the molecular formula C7H8N4O2S and a molecular weight of 212.23 g/mol. Its IUPAC name is N-(1H-pyrazolo[5,4-b]pyridin-3-yl)methanesulfonamide.
| Compound Name | N-(1H-pyrazolo[5,4-b]pyridin-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 110868117 |
| Molecular Formula | C7H8N4O2S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | N-(1H-pyrazolo[5,4-b]pyridin-3-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1n[nH]c2ncccc12 |
| InChI | InChI=1S/C7H8N4O2S/c1-14(12,13)11-7-5-3-2-4-8-6(5)9-10-7/h2-4H,1H3,(H2,8,9,10,11) |
| InChIKey | WSLGQDFJQRYXIU-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |