C16H26O4 — CID 11087251
(8S,9S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8-prop-1-en-2-yl-6,10-dioxaspiro[4.5]decane (PubChem CID 11087251) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (8S,9S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8-prop-1-en-2-yl-6,10-dioxaspiro[4.5]decane.
| Compound Name | (8S,9S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8-prop-1-en-2-yl-6,10-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 11087251 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (8S,9S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8-prop-1-en-2-yl-6,10-dioxaspiro[4.5]decane |
| SMILES | C=C(C)[C@H]1COC2(CCCC2)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H26O4/c1-11(2)12-9-18-16(7-5-6-8-16)20-14(12)13-10-17-15(3,4)19-13/h12-14H,1,5-10H2,2-4H3/t12-,13-,14+/m1/s1 |
| InChIKey | QKUWOUJIOCZQKF-MCIONIFRSA-N |
| XLogP | 3.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|