C18H19N3O2S — CID 110872577
4-(2,5-dimethylphenyl)sulfonyl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene (PubChem CID 110872577) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)sulfonyl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene.
| Compound Name | 4-(2,5-dimethylphenyl)sulfonyl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
|---|---|
| PubChem CID | 110872577 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 4-(2,5-dimethylphenyl)sulfonyl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCc3nc4ccccn4c3C2)c1 |
| InChI | InChI=1S/C18H19N3O2S/c1-13-6-7-14(2)17(11-13)24(22,23)20-10-8-15-16(12-20)21-9-4-3-5-18(21)19-15/h3-7,9,11H,8,10,12H2,1-2H3 |
| InChIKey | GOZBZGPGQYAHRT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |