C14H15N5O2S2 — CID 110873281
4-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 110873281) has the molecular formula C14H15N5O2S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is 4-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 110873281 |
| Molecular Formula | C14H15N5O2S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 4-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | O=S(=O)(c1cccs1)N1CCN(c2ncnc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C14H15N5O2S2/c20-23(21,12-2-1-9-22-12)19-7-5-18(6-8-19)14-11-3-4-15-13(11)16-10-17-14/h1-4,9-10H,5-8H2,(H,15,16,17) |
| InChIKey | DBOWOBIMRDJXQF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |