C15H18N2O4S — CID 11088561
(3S,3aR,4R,6aS)-4-ethoxy-3-methyl-6a-[(S)-(4-methylphenyl)sulfinyl]-3a,4-dihydro-3H-furo[3,4-c]pyrazol-6-one (PubChem CID 11088561) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is (3S,3aR,4R,6aS)-4-ethoxy-3-methyl-6a-[(S)-(4-methylphenyl)sulfinyl]-3a,4-dihydro-3H-furo[3,4-c]pyrazol-6-one.
| Compound Name | (3S,3aR,4R,6aS)-4-ethoxy-3-methyl-6a-[(S)-(4-methylphenyl)sulfinyl]-3a,4-dihydro-3H-furo[3,4-c]pyrazol-6-one |
|---|---|
| PubChem CID | 11088561 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (3S,3aR,4R,6aS)-4-ethoxy-3-methyl-6a-[(S)-(4-methylphenyl)sulfinyl]-3a,4-dihydro-3H-furo[3,4-c]pyrazol-6-one |
| SMILES | CCO[C@@H]1OC(=O)[C@]2([S@@](=O)c3ccc(C)cc3)N=N[C@@H](C)[C@H]12 |
| InChI | InChI=1S/C15H18N2O4S/c1-4-20-13-12-10(3)16-17-15(12,14(18)21-13)22(19)11-7-5-9(2)6-8-11/h5-8,10,12-13H,4H2,1-3H3/t10-,12+,13+,15-,22-/m0/s1 |
| InChIKey | OVTYISXLBVYBFT-DHURAINYSA-N |
| XLogP | 2.19 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |