C17H21NO5S — CID 101375794
(1S,2R,5R,6S)-5-ethoxy-2-(4-methylphenyl)sulfinyl-4,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-3-one (PubChem CID 101375794) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is (1S,2R,5R,6S)-5-ethoxy-2-(4-methylphenyl)sulfinyl-4,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-3-one.
| Compound Name | (1S,2R,5R,6S)-5-ethoxy-2-(4-methylphenyl)sulfinyl-4,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-3-one |
|---|---|
| PubChem CID | 101375794 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (1S,2R,5R,6S)-5-ethoxy-2-(4-methylphenyl)sulfinyl-4,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-3-one |
| SMILES | CCO[C@@H]1OC(=O)[C@@]2(S(=O)c3ccc(C)cc3)[C@@H]3CCCN3O[C@@H]12 |
| InChI | InChI=1S/C17H21NO5S/c1-3-21-15-14-17(16(19)22-15,13-5-4-10-18(13)23-14)24(20)12-8-6-11(2)7-9-12/h6-9,13-15H,3-5,10H2,1-2H3/t13-,14-,15+,17+,24?/m0/s1 |
| InChIKey | GQJRQPVQLHGTFZ-CTCFVXBWSA-N |
| XLogP | 1.54 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |