C21H25NO5 — CID 11090015
methyl 4-[[(3aR,7aS)-4-tert-butyl-1,3,6-trioxo-4,5,7,7a-tetrahydro-3aH-isoindol-2-yl]methyl]benzoate (PubChem CID 11090015) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is methyl 4-[[(3aR,7aS)-4-tert-butyl-1,3,6-trioxo-4,5,7,7a-tetrahydro-3aH-isoindol-2-yl]methyl]benzoate.
| Compound Name | methyl 4-[[(3aR,7aS)-4-tert-butyl-1,3,6-trioxo-4,5,7,7a-tetrahydro-3aH-isoindol-2-yl]methyl]benzoate |
|---|---|
| PubChem CID | 11090015 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | methyl 4-[[(3aR,7aS)-4-tert-butyl-1,3,6-trioxo-4,5,7,7a-tetrahydro-3aH-isoindol-2-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C(=O)[C@H]3CC(=O)CC(C(C)(C)C)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C21H25NO5/c1-21(2,3)16-10-14(23)9-15-17(16)19(25)22(18(15)24)11-12-5-7-13(8-6-12)20(26)27-4/h5-8,15-17H,9-11H2,1-4H3/t15-,16?,17-/m0/s1 |
| InChIKey | DTDBIVSFMXHKBP-QRFGZVGRSA-N |
| XLogP | 2.60 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|