C24H26N2O6S — CID 98226714
methyl 4-[[5-[[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-2-methylphenyl]sulfonylamino]benzoate (PubChem CID 98226714) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is methyl 4-[[5-[[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-2-methylphenyl]sulfonylamino]benzoate.
| Compound Name | methyl 4-[[5-[[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-2-methylphenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 98226714 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | methyl 4-[[5-[[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-2-methylphenyl]sulfonylamino]benzoate |
| SMILES | COC(=O)c1ccc(NS(=O)(=O)c2cc(CN3C(=O)[C@H]4CCCC[C@H]4C3=O)ccc2C)cc1 |
| InChI | InChI=1S/C24H26N2O6S/c1-15-7-8-16(14-26-22(27)19-5-3-4-6-20(19)23(26)28)13-21(15)33(30,31)25-18-11-9-17(10-12-18)24(29)32-2/h7-13,19-20,25H,3-6,14H2,1-2H3/t19-,20+ |
| InChIKey | LVKPJDMISWHSJQ-BGYRXZFFSA-N |
| XLogP | 3.26 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|