C24H26N2O5S — CID 46296224
N-(4-acetylphenyl)-5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methylbenzenesulfonamide (PubChem CID 46296224) has the molecular formula C24H26N2O5S and a molecular weight of 454.55 g/mol. Its IUPAC name is N-(4-acetylphenyl)-5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methylbenzenesulfonamide.
| Compound Name | N-(4-acetylphenyl)-5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 46296224 |
| Molecular Formula | C24H26N2O5S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | N-(4-acetylphenyl)-5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methylbenzenesulfonamide |
| SMILES | CC(=O)c1ccc(NS(=O)(=O)c2cc(CN3C(=O)C4CCCCC4C3=O)ccc2C)cc1 |
| InChI | InChI=1S/C24H26N2O5S/c1-15-7-8-17(14-26-23(28)20-5-3-4-6-21(20)24(26)29)13-22(15)32(30,31)25-19-11-9-18(10-12-19)16(2)27/h7-13,20-21,25H,3-6,14H2,1-2H3 |
| InChIKey | KIPGTALRVCQNQB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|