C25H30O4 — CID 11090520
(1S,5S,7S)-2',4'-ditert-butyl-5-phenylspiro[6,8-dioxabicyclo[3.2.1]octane-7,6'-cyclohexa-2,4-diene]-1',2-dione (PubChem CID 11090520) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is (1S,5S,7S)-2',4'-ditert-butyl-5-phenylspiro[6,8-dioxabicyclo[3.2.1]octane-7,6'-cyclohexa-2,4-diene]-1',2-dione.
| Compound Name | (1S,5S,7S)-2',4'-ditert-butyl-5-phenylspiro[6,8-dioxabicyclo[3.2.1]octane-7,6'-cyclohexa-2,4-diene]-1',2-dione |
|---|---|
| PubChem CID | 11090520 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (1S,5S,7S)-2',4'-ditert-butyl-5-phenylspiro[6,8-dioxabicyclo[3.2.1]octane-7,6'-cyclohexa-2,4-diene]-1',2-dione |
| SMILES | CC(C)(C)C1=C[C@@]2(O[C@]3(c4ccccc4)CCC(=O)[C@H]2O3)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C25H30O4/c1-22(2,3)17-14-18(23(4,5)6)20(27)24(15-17)21-19(26)12-13-25(28-21,29-24)16-10-8-7-9-11-16/h7-11,14-15,21H,12-13H2,1-6H3/t21-,24-,25+/m1/s1 |
| InChIKey | VCUSLVNLNUDGOG-SDUSCBPUSA-N |
| XLogP | 4.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |