C25H32N2O4 — CID 11091175
1-adamantyl 2-[2-(diethylamino)ethyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 11091175) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is 1-adamantyl 2-[2-(diethylamino)ethyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 1-adamantyl 2-[2-(diethylamino)ethyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 11091175 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 1-adamantyl 2-[2-(diethylamino)ethyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCN(CC)CCN1C(=O)c2ccc(C(=O)OC34CC5CC(CC(C5)C3)C4)cc2C1=O |
| InChI | InChI=1S/C25H32N2O4/c1-3-26(4-2)7-8-27-22(28)20-6-5-19(12-21(20)23(27)29)24(30)31-25-13-16-9-17(14-25)11-18(10-16)15-25/h5-6,12,16-18H,3-4,7-11,13-15H2,1-2H3 |
| InChIKey | QHQMTDMCEFTFPF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|