C12H16F3N5 — CID 110917251
N'-(1,4,5,6-tetrahydropyrimidin-2-yl)-N-[3-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine (PubChem CID 110917251) has the molecular formula C12H16F3N5 and a molecular weight of 287.29 g/mol. Its IUPAC name is N'-(1,4,5,6-tetrahydropyrimidin-2-yl)-N-[3-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine.
| Compound Name | N'-(1,4,5,6-tetrahydropyrimidin-2-yl)-N-[3-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 110917251 |
| Molecular Formula | C12H16F3N5 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N'-(1,4,5,6-tetrahydropyrimidin-2-yl)-N-[3-(trifluoromethyl)-2-pyridinyl]ethane-1,2-diamine |
| SMILES | FC(F)(F)c1cccnc1NCCNC1=NCCCN1 |
| InChI | InChI=1S/C12H16F3N5/c13-12(14,15)9-3-1-4-16-10(9)17-7-8-20-11-18-5-2-6-19-11/h1,3-4H,2,5-8H2,(H,16,17)(H2,18,19,20) |
| InChIKey | ZTKQLECFHHAAIE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|