C12H18FIN4O — CID 110917981
N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-2-fluorobenzamide;hydroiodide (PubChem CID 110917981) has the molecular formula C12H18FIN4O and a molecular weight of 380.21 g/mol. Its IUPAC name is N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-2-fluorobenzamide;hydroiodide.
| Compound Name | N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-2-fluorobenzamide;hydroiodide |
|---|---|
| PubChem CID | 110917981 |
| Molecular Formula | C12H18FIN4O |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-2-fluorobenzamide;hydroiodide |
| SMILES | C/N=C(\NC)NCCNC(=O)c1ccccc1F.I |
| InChI | InChI=1S/C12H17FN4O.HI/c1-14-12(15-2)17-8-7-16-11(18)9-5-3-4-6-10(9)13;/h3-6H,7-8H2,1-2H3,(H,16,18)(H2,14,15,17);1H |
| InChIKey | IZWXUDDJHVPICZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|