C16H24Cl2IN3O2 — CID 110921016
N'-[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]-4-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 110921016) has the molecular formula C16H24Cl2IN3O2 and a molecular weight of 488.20 g/mol. Its IUPAC name is N'-[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]-4-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]-4-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110921016 |
| Molecular Formula | C16H24Cl2IN3O2 |
| Molecular Weight | 488.20 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | N'-[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]-4-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CC1CCN(/C(N)=N/CC(O)COc2cccc(Cl)c2Cl)CC1.I |
| InChI | InChI=1S/C16H23Cl2N3O2.HI/c1-11-5-7-21(8-6-11)16(19)20-9-12(22)10-23-14-4-2-3-13(17)15(14)18;/h2-4,11-12,22H,5-10H2,1H3,(H2,19,20);1H |
| InChIKey | LWHGERFBTDWHNW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.20 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|