C16H26Cl2IN3O2 — CID 111082740
2-[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]-1-hexylguanidine;hydroiodide (PubChem CID 111082740) has the molecular formula C16H26Cl2IN3O2 and a molecular weight of 490.21 g/mol. Its IUPAC name is 2-[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]-1-hexylguanidine;hydroiodide.
| Compound Name | 2-[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]-1-hexylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111082740 |
| Molecular Formula | C16H26Cl2IN3O2 |
| Molecular Weight | 490.21 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | 2-[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]-1-hexylguanidine;hydroiodide |
| SMILES | CCCCCCN/C(N)=N/CC(O)COc1cccc(Cl)c1Cl.I |
| InChI | InChI=1S/C16H25Cl2N3O2.HI/c1-2-3-4-5-9-20-16(19)21-10-12(22)11-23-14-8-6-7-13(17)15(14)18;/h6-8,12,22H,2-5,9-11H2,1H3,(H3,19,20,21);1H |
| InChIKey | UCRQAVRXRQFZLZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.21 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|