C26H30N4O7 — CID 11092433
1-O-tert-butyl 4-O-[(Z)-(1,3-diamino-3-oxopropylidene)amino] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate (PubChem CID 11092433) has the molecular formula C26H30N4O7 and a molecular weight of 510.55 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-[(Z)-(1,3-diamino-3-oxopropylidene)amino] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate.
| Compound Name | 1-O-tert-butyl 4-O-[(Z)-(1,3-diamino-3-oxopropylidene)amino] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate |
|---|---|
| PubChem CID | 11092433 |
| Molecular Formula | C26H30N4O7 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 1-O-tert-butyl 4-O-[(Z)-(1,3-diamino-3-oxopropylidene)amino] (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioate |
| SMILES | CC(C)(C)OC(=O)[C@H](CC(=O)O/N=C(\N)CC(N)=O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H30N4O7/c1-26(2,3)36-24(33)20(12-23(32)37-30-21(27)13-22(28)31)29-25(34)35-14-19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h4-11,19-20H,12-14H2,1-3H3,(H2,27,30)(H2,28,31)(H,29,34)/t20-/m0/s1 |
| InChIKey | HXVFVSZWTNWTHB-FQEVSTJZSA-N |
| XLogP | 2.32 |
| TPSA | 172.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|