C17H19ClN4O — CID 110926197
4-[[amino(anilino)methylidene]amino]-N-(4-chlorophenyl)butanamide (PubChem CID 110926197) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is 4-[[amino(anilino)methylidene]amino]-N-(4-chlorophenyl)butanamide.
| Compound Name | 4-[[amino(anilino)methylidene]amino]-N-(4-chlorophenyl)butanamide |
|---|---|
| PubChem CID | 110926197 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 4-[[amino(anilino)methylidene]amino]-N-(4-chlorophenyl)butanamide |
| SMILES | N/C(=N\CCCC(=O)Nc1ccc(Cl)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C17H19ClN4O/c18-13-8-10-15(11-9-13)21-16(23)7-4-12-20-17(19)22-14-5-2-1-3-6-14/h1-3,5-6,8-11H,4,7,12H2,(H,21,23)(H3,19,20,22) |
| InChIKey | ZNXUKQZFYIPTRK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|