C27H50O7Si2 — CID 11092790
(1S,3S,7S,10R,11S,12S,16R)-3-acetyl-8,8,10,12-tetramethyl-7,11-bis(trimethylsilyloxy)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 11092790) has the molecular formula C27H50O7Si2 and a molecular weight of 542.86 g/mol. Its IUPAC name is (1S,3S,7S,10R,11S,12S,16R)-3-acetyl-8,8,10,12-tetramethyl-7,11-bis(trimethylsilyloxy)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,11S,12S,16R)-3-acetyl-8,8,10,12-tetramethyl-7,11-bis(trimethylsilyloxy)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 11092790 |
| Molecular Formula | C27H50O7Si2 |
| Molecular Weight | 542.86 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | (1S,3S,7S,10R,11S,12S,16R)-3-acetyl-8,8,10,12-tetramethyl-7,11-bis(trimethylsilyloxy)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC(=O)[C@@H]1C[C@@H]2O[C@@H]2CCC[C@H](C)[C@H](O[Si](C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@@H](O[Si](C)(C)C)CC(=O)O1 |
| InChI | InChI=1S/C27H50O7Si2/c1-17-13-12-14-20-22(31-20)15-21(19(3)28)32-24(29)16-23(33-35(6,7)8)27(4,5)26(30)18(2)25(17)34-36(9,10)11/h17-18,20-23,25H,12-16H2,1-11H3/t17-,18+,20+,21-,22-,23-,25-/m0/s1 |
| InChIKey | QPZLAXZVZKHEBT-GFNPVBPLSA-N |
| XLogP | 5.53 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.86 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|