C30H60O6Si2 — CID 101335977
methyl (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5,12-dioxotridecanoate (PubChem CID 101335977) has the molecular formula C30H60O6Si2 and a molecular weight of 572.98 g/mol. Its IUPAC name is methyl (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5,12-dioxotridecanoate.
| Compound Name | methyl (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5,12-dioxotridecanoate |
|---|---|
| PubChem CID | 101335977 |
| Molecular Formula | C30H60O6Si2 |
| Molecular Weight | 572.98 g/mol |
| Exact Mass | 572.39 |
| IUPAC Name | methyl (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5,12-dioxotridecanoate |
| SMILES | COC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CCCC(C)=O |
| InChI | InChI=1S/C30H60O6Si2/c1-21(18-17-19-22(2)31)26(36-38(15,16)29(7,8)9)23(3)27(33)30(10,11)24(20-25(32)34-12)35-37(13,14)28(4,5)6/h21,23-24,26H,17-20H2,1-16H3/t21-,23+,24-,26-/m0/s1 |
| InChIKey | XYFNKDCOFLBFGY-YUZJIJRXSA-N |
| XLogP | 7.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.98 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|