C29H54O6Si2 — CID 52920747
(1S,3S,7S,10R,11S,12S,16S)-3-acetyl-8,8,10,12,16-pentamethyl-7,11-bis(trimethylsilyloxy)-4-oxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 52920747) has the molecular formula C29H54O6Si2 and a molecular weight of 554.92 g/mol. Its IUPAC name is (1S,3S,7S,10R,11S,12S,16S)-3-acetyl-8,8,10,12,16-pentamethyl-7,11-bis(trimethylsilyloxy)-4-oxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,11S,12S,16S)-3-acetyl-8,8,10,12,16-pentamethyl-7,11-bis(trimethylsilyloxy)-4-oxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 52920747 |
| Molecular Formula | C29H54O6Si2 |
| Molecular Weight | 554.92 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | (1S,3S,7S,10R,11S,12S,16S)-3-acetyl-8,8,10,12,16-pentamethyl-7,11-bis(trimethylsilyloxy)-4-oxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC(=O)[C@@H]1C[C@@H]2C[C@]2(C)CCC[C@H](C)[C@H](O[Si](C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@@H](O[Si](C)(C)C)CC(=O)O1 |
| InChI | InChI=1S/C29H54O6Si2/c1-19-14-13-15-29(6)18-22(29)16-23(21(3)30)33-25(31)17-24(34-36(7,8)9)28(4,5)27(32)20(2)26(19)35-37(10,11)12/h19-20,22-24,26H,13-18H2,1-12H3/t19-,20+,22+,23-,24-,26-,29-/m0/s1 |
| InChIKey | DOPAQRADDVUYAZ-BGVFVPGASA-N |
| XLogP | 6.79 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.92 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|