C15H15ClN4O2 — CID 110929154
1-[3-(4-chlorophenyl)-1-(2-hydroxyethyl)pyrazol-5-yl]-3-prop-2-ynylurea (PubChem CID 110929154) has the molecular formula C15H15ClN4O2 and a molecular weight of 318.76 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-1-(2-hydroxyethyl)pyrazol-5-yl]-3-prop-2-ynylurea.
| Compound Name | 1-[3-(4-chlorophenyl)-1-(2-hydroxyethyl)pyrazol-5-yl]-3-prop-2-ynylurea |
|---|---|
| PubChem CID | 110929154 |
| Molecular Formula | C15H15ClN4O2 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-1-(2-hydroxyethyl)pyrazol-5-yl]-3-prop-2-ynylurea |
| SMILES | C#CCNC(=O)Nc1cc(-c2ccc(Cl)cc2)nn1CCO |
| InChI | InChI=1S/C15H15ClN4O2/c1-2-7-17-15(22)18-14-10-13(19-20(14)8-9-21)11-3-5-12(16)6-4-11/h1,3-6,10,21H,7-9H2,(H2,17,18,22) |
| InChIKey | NFTAUOAZSGWRJQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|