C16H16ClN5O2 — CID 111477338
N-[3-(4-chlorophenyl)-1-(2-hydroxyethyl)pyrazol-5-yl]-2-(1H-pyrazol-5-yl)acetamide (PubChem CID 111477338) has the molecular formula C16H16ClN5O2 and a molecular weight of 345.79 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)-1-(2-hydroxyethyl)pyrazol-5-yl]-2-(1H-pyrazol-5-yl)acetamide.
| Compound Name | N-[3-(4-chlorophenyl)-1-(2-hydroxyethyl)pyrazol-5-yl]-2-(1H-pyrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 111477338 |
| Molecular Formula | C16H16ClN5O2 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N-[3-(4-chlorophenyl)-1-(2-hydroxyethyl)pyrazol-5-yl]-2-(1H-pyrazol-5-yl)acetamide |
| SMILES | O=C(Cc1ccn[nH]1)Nc1cc(-c2ccc(Cl)cc2)nn1CCO |
| InChI | InChI=1S/C16H16ClN5O2/c17-12-3-1-11(2-4-12)14-10-15(22(21-14)7-8-23)19-16(24)9-13-5-6-18-20-13/h1-6,10,23H,7-9H2,(H,18,20)(H,19,24) |
| InChIKey | MSGMTQURRRRSIL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |