C19H23ClN4O3 — CID 126774750
1-acetyl-N-[3-(4-chlorophenyl)-1-(2-hydroxyethyl)pyrazol-5-yl]piperidine-3-carboxamide (PubChem CID 126774750) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is 1-acetyl-N-[3-(4-chlorophenyl)-1-(2-hydroxyethyl)pyrazol-5-yl]piperidine-3-carboxamide.
| Compound Name | 1-acetyl-N-[3-(4-chlorophenyl)-1-(2-hydroxyethyl)pyrazol-5-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 126774750 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-acetyl-N-[3-(4-chlorophenyl)-1-(2-hydroxyethyl)pyrazol-5-yl]piperidine-3-carboxamide |
| SMILES | CC(=O)N1CCCC(C(=O)Nc2cc(-c3ccc(Cl)cc3)nn2CCO)C1 |
| InChI | InChI=1S/C19H23ClN4O3/c1-13(26)23-8-2-3-15(12-23)19(27)21-18-11-17(22-24(18)9-10-25)14-4-6-16(20)7-5-14/h4-7,11,15,25H,2-3,8-10,12H2,1H3,(H,21,27) |
| InChIKey | XHKAIBOTVZOTAE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |