C16H16ClN5O2 — CID 136543276
N-[3-(4-chlorophenyl)-1-(2-hydroxyethyl)pyrazol-5-yl]-3-methylimidazole-4-carboxamide (PubChem CID 136543276) has the molecular formula C16H16ClN5O2 and a molecular weight of 345.79 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)-1-(2-hydroxyethyl)pyrazol-5-yl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-[3-(4-chlorophenyl)-1-(2-hydroxyethyl)pyrazol-5-yl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 136543276 |
| Molecular Formula | C16H16ClN5O2 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N-[3-(4-chlorophenyl)-1-(2-hydroxyethyl)pyrazol-5-yl]-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cncc1C(=O)Nc1cc(-c2ccc(Cl)cc2)nn1CCO |
| InChI | InChI=1S/C16H16ClN5O2/c1-21-10-18-9-14(21)16(24)19-15-8-13(20-22(15)6-7-23)11-2-4-12(17)5-3-11/h2-5,8-10,23H,6-7H2,1H3,(H,19,24) |
| InChIKey | UPDBFFLJUGUEJC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |