C20H26FIN4O — CID 110950611
2-[[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide (PubChem CID 110950611) has the molecular formula C20H26FIN4O and a molecular weight of 484.36 g/mol. Its IUPAC name is 2-[[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide.
| Compound Name | 2-[[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 110950611 |
| Molecular Formula | C20H26FIN4O |
| Molecular Weight | 484.36 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 2-[[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide |
| SMILES | C/N=C(/NCC(Cc1ccc(F)cc1)C(N)=O)N(C)Cc1ccccc1.I |
| InChI | InChI=1S/C20H25FN4O.HI/c1-23-20(25(2)14-16-6-4-3-5-7-16)24-13-17(19(22)26)12-15-8-10-18(21)11-9-15;/h3-11,17H,12-14H2,1-2H3,(H2,22,26)(H,23,24);1H |
| InChIKey | DUCSOUWWINBABX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|