C19H21FIN3 — CID 110984945
N-[2-(2-fluorophenyl)cyclopropyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide (PubChem CID 110984945) has the molecular formula C19H21FIN3 and a molecular weight of 437.30 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)cyclopropyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(2-fluorophenyl)cyclopropyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110984945 |
| Molecular Formula | C19H21FIN3 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | N-[2-(2-fluorophenyl)cyclopropyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NC1CC1c1ccccc1F)N1CCc2ccccc21.I |
| InChI | InChI=1S/C19H20FN3.HI/c1-21-19(23-11-10-13-6-2-5-9-18(13)23)22-17-12-15(17)14-7-3-4-8-16(14)20;/h2-9,15,17H,10-12H2,1H3,(H,21,22);1H |
| InChIKey | FQVMQMGPENXQCH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|