C19H32N6O3 — CID 110994941
ethyl 1-[N'-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]carbamimidoyl]piperidine-3-carboxylate (PubChem CID 110994941) has the molecular formula C19H32N6O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]carbamimidoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[N'-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]carbamimidoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110994941 |
| Molecular Formula | C19H32N6O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]carbamimidoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(/C(=N\C)NCCCn2nc3n(c2=O)CCCC3)C1 |
| InChI | InChI=1S/C19H32N6O3/c1-3-28-17(26)15-8-6-11-23(14-15)18(20-2)21-10-7-13-25-19(27)24-12-5-4-9-16(24)22-25/h15H,3-14H2,1-2H3,(H,20,21) |
| InChIKey | YCPZFYXBGSROPJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|