C17H27N3O4 — CID 11099797
tert-butyl (2S)-2-[(3aS,6S,6aR)-6-methyl-5-oxo-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 11099797) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3aS,6S,6aR)-6-methyl-5-oxo-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(3aS,6S,6aR)-6-methyl-5-oxo-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11099797 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | tert-butyl (2S)-2-[(3aS,6S,6aR)-6-methyl-5-oxo-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | C[C@@H]1C(=O)N[C@H]2CCN(C(=O)[C@@H]3CCCN3C(=O)OC(C)(C)C)[C@@H]21 |
| InChI | InChI=1S/C17H27N3O4/c1-10-13-11(18-14(10)21)7-9-20(13)15(22)12-6-5-8-19(12)16(23)24-17(2,3)4/h10-13H,5-9H2,1-4H3,(H,18,21)/t10-,11-,12-,13+/m0/s1 |
| InChIKey | DETPFNDHJIXZKZ-ZDEQEGDKSA-N |
| XLogP | 1.12 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |