C19H36IN5O2S — CID 110998226
1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 110998226) has the molecular formula C19H36IN5O2S and a molecular weight of 525.50 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110998226 |
| Molecular Formula | C19H36IN5O2S |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(S(N)(=O)=O)c1)NC(C)CCCN(CC)CC.I |
| InChI | InChI=1S/C19H35N5O2S.HI/c1-5-21-19(23-16(4)10-9-13-24(6-2)7-3)22-15-17-11-8-12-18(14-17)27(20,25)26;/h8,11-12,14,16H,5-7,9-10,13,15H2,1-4H3,(H2,20,25,26)(H2,21,22,23);1H |
| InChIKey | DXOGSFHCGYOMSW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|