C13H28SiTe — CID 11099868
[(Z)-1-butyltellanyl-3,3-dimethylbut-1-enyl]-trimethylsilane (PubChem CID 11099868) has the molecular formula C13H28SiTe and a molecular weight of 340.05 g/mol. Its IUPAC name is [(Z)-1-butyltellanyl-3,3-dimethylbut-1-enyl]-trimethylsilane.
| Compound Name | [(Z)-1-butyltellanyl-3,3-dimethylbut-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 11099868 |
| Molecular Formula | C13H28SiTe |
| Molecular Weight | 340.05 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | [(Z)-1-butyltellanyl-3,3-dimethylbut-1-enyl]-trimethylsilane |
| SMILES | CCCC[Te]/C(=C\C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C13H28SiTe/c1-8-9-10-15-12(14(5,6)7)11-13(2,3)4/h11H,8-10H2,1-7H3/b12-11- |
| InChIKey | RPEMVXBBNQCSIE-QXMHVHEDSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.05 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|