C10H18SeSi — CID 12634300
3,3-dimethyl-2-trimethylsilylpenta-1,4-diene-1-selone (PubChem CID 12634300) has the molecular formula C10H18SeSi and a molecular weight of 245.30 g/mol. Its IUPAC name is 3,3-dimethyl-2-trimethylsilylpenta-1,4-diene-1-selone.
| Compound Name | 3,3-dimethyl-2-trimethylsilylpenta-1,4-diene-1-selone |
|---|---|
| PubChem CID | 12634300 |
| Molecular Formula | C10H18SeSi |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 3,3-dimethyl-2-trimethylsilylpenta-1,4-diene-1-selone |
| SMILES | C=CC(C)(C)C(=C=[Se])[Si](C)(C)C |
| InChI | InChI=1S/C10H18SeSi/c1-7-10(2,3)9(8-11)12(4,5)6/h7H,1H2,2-6H3 |
| InChIKey | ATFOLRNCHUIUGV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|