C8H7Cl5N2O2 — CID 11099888
(1Z)-N-[carbonochloridoyl(propyl)carbamoyl]-2,3,3-trichloroprop-2-enimidoyl chloride (PubChem CID 11099888) has the molecular formula C8H7Cl5N2O2 and a molecular weight of 340.42 g/mol. Its IUPAC name is (1Z)-N-[carbonochloridoyl(propyl)carbamoyl]-2,3,3-trichloroprop-2-enimidoyl chloride.
| Compound Name | (1Z)-N-[carbonochloridoyl(propyl)carbamoyl]-2,3,3-trichloroprop-2-enimidoyl chloride |
|---|---|
| PubChem CID | 11099888 |
| Molecular Formula | C8H7Cl5N2O2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 337.90 |
| IUPAC Name | (1Z)-N-[carbonochloridoyl(propyl)carbamoyl]-2,3,3-trichloroprop-2-enimidoyl chloride |
| SMILES | CCCN(C(=O)Cl)C(=O)/N=C(\Cl)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C8H7Cl5N2O2/c1-2-3-15(7(13)16)8(17)14-6(12)4(9)5(10)11/h2-3H2,1H3/b14-6- |
| InChIKey | SEKVFQGVDIIUAO-NSIKDUERSA-N |
| XLogP | 4.70 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|