C25H43IN6 — CID 110999822
2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-[5-(diethylamino)pentan-2-yl]-3-ethylguanidine;hydroiodide (PubChem CID 110999822) has the molecular formula C25H43IN6 and a molecular weight of 554.57 g/mol. Its IUPAC name is 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-[5-(diethylamino)pentan-2-yl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-[5-(diethylamino)pentan-2-yl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110999822 |
| Molecular Formula | C25H43IN6 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-1-[5-(diethylamino)pentan-2-yl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(C)nn(Cc2ccccc2)c1C)NC(C)CCCN(CC)CC.I |
| InChI | InChI=1S/C25H42N6.HI/c1-7-26-25(28-20(4)14-13-17-30(8-2)9-3)27-18-24-21(5)29-31(22(24)6)19-23-15-11-10-12-16-23;/h10-12,15-16,20H,7-9,13-14,17-19H2,1-6H3,(H2,26,27,28);1H |
| InChIKey | HSCRRZDLUIWSHW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|