C19H33N3O3 — CID 111001115
2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-(3-methylbutan-2-yl)guanidine (PubChem CID 111001115) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-(3-methylbutan-2-yl)guanidine.
| Compound Name | 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-(3-methylbutan-2-yl)guanidine |
|---|---|
| PubChem CID | 111001115 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-(3-methylbutan-2-yl)guanidine |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OCC)c(OC)c1)NC(C)C(C)C |
| InChI | InChI=1S/C19H33N3O3/c1-8-20-19(22-14(5)13(3)4)21-12-15-10-16(23-6)18(25-9-2)17(11-15)24-7/h10-11,13-14H,8-9,12H2,1-7H3,(H2,20,21,22) |
| InChIKey | HVJGJLVGSUNWLE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|