C20H37N5O2 — CID 111003957
N-cyclopropyl-4-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]butanamide (PubChem CID 111003957) has the molecular formula C20H37N5O2 and a molecular weight of 379.55 g/mol. Its IUPAC name is N-cyclopropyl-4-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]butanamide.
| Compound Name | N-cyclopropyl-4-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]butanamide |
|---|---|
| PubChem CID | 111003957 |
| Molecular Formula | C20H37N5O2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.29 |
| IUPAC Name | N-cyclopropyl-4-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]butanamide |
| SMILES | C/N=C(\NCCCC(=O)NC1CC1)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C20H37N5O2/c1-21-19(22-11-5-6-18(26)24-17-7-8-17)23-16-20(9-3-2-4-10-20)25-12-14-27-15-13-25/h17H,2-16H2,1H3,(H,24,26)(H2,21,22,23) |
| InChIKey | QXHQSSBUYLARBF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|