C18H32F3N5O2 — CID 111499871
N-methyl-2-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 111499871) has the molecular formula C18H32F3N5O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is N-methyl-2-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-methyl-2-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 111499871 |
| Molecular Formula | C18H32F3N5O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | N-methyl-2-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C/N=C(\NCC(=O)N(C)CC(F)(F)F)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C18H32F3N5O2/c1-22-16(23-12-15(27)25(2)14-18(19,20)21)24-13-17(6-4-3-5-7-17)26-8-10-28-11-9-26/h3-14H2,1-2H3,(H2,22,23,24) |
| InChIKey | KNIGFNIEFCQRJK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|