C22H18O5 — CID 11100534
(1S)-5,8-dimethoxy-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2,4,6,8,10,13(20),15-heptaene-12,17-dione (PubChem CID 11100534) has the molecular formula C22H18O5 and a molecular weight of 362.38 g/mol. Its IUPAC name is (1S)-5,8-dimethoxy-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2,4,6,8,10,13(20),15-heptaene-12,17-dione.
| Compound Name | (1S)-5,8-dimethoxy-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2,4,6,8,10,13(20),15-heptaene-12,17-dione |
|---|---|
| PubChem CID | 11100534 |
| Molecular Formula | C22H18O5 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (1S)-5,8-dimethoxy-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2,4,6,8,10,13(20),15-heptaene-12,17-dione |
| SMILES | COc1ccc(OC)c2cc3c(cc12)C(=O)c1occ2c1[C@@]3(C)CCC2=O |
| InChI | InChI=1S/C22H18O5/c1-22-7-6-16(23)14-10-27-21(19(14)22)20(24)13-8-11-12(9-15(13)22)18(26-3)5-4-17(11)25-2/h4-5,8-10H,6-7H2,1-3H3/t22-/m0/s1 |
| InChIKey | HJGVPGQUGOEPRF-QFIPXVFZSA-N |
| XLogP | 4.28 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |