C21H14O6 — CID 74052407
7-methoxy-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2(11),3,6,9,13(20),15-hexaene-5,8,12,17-tetrone (PubChem CID 74052407) has the molecular formula C21H14O6 and a molecular weight of 362.34 g/mol. Its IUPAC name is 7-methoxy-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2(11),3,6,9,13(20),15-hexaene-5,8,12,17-tetrone.
| Compound Name | 7-methoxy-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2(11),3,6,9,13(20),15-hexaene-5,8,12,17-tetrone |
|---|---|
| PubChem CID | 74052407 |
| Molecular Formula | C21H14O6 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 7-methoxy-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2(11),3,6,9,13(20),15-hexaene-5,8,12,17-tetrone |
| SMILES | COC1=CC(=O)c2cc3c(cc2C1=O)C(=O)c1occ2c1C3(C)CCC2=O |
| InChI | InChI=1S/C21H14O6/c1-21-4-3-14(22)12-8-27-20(17(12)21)19(25)11-5-10-9(6-13(11)21)15(23)7-16(26-2)18(10)24/h5-8H,3-4H2,1-2H3 |
| InChIKey | PMWOBGBLDUHMIY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|