C20H16O10S2 — CID 162974637
[(1S)-1-methyl-12-oxo-5-sulfooxy-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2,4,6,8,10,13(20),15-heptaen-8-yl] hydrogen sulfate (PubChem CID 162974637) has the molecular formula C20H16O10S2 and a molecular weight of 480.47 g/mol. Its IUPAC name is [(1S)-1-methyl-12-oxo-5-sulfooxy-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2,4,6,8,10,13(20),15-heptaen-8-yl] hydrogen sulfate.
| Compound Name | [(1S)-1-methyl-12-oxo-5-sulfooxy-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2,4,6,8,10,13(20),15-heptaen-8-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 162974637 |
| Molecular Formula | C20H16O10S2 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | [(1S)-1-methyl-12-oxo-5-sulfooxy-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2,4,6,8,10,13(20),15-heptaen-8-yl] hydrogen sulfate |
| SMILES | C[C@@]12CCCc3coc(c31)C(=O)c1cc3c(OS(=O)(=O)O)ccc(OS(=O)(=O)O)c3cc12 |
| InChI | InChI=1S/C20H16O10S2/c1-20-6-2-3-10-9-28-19(17(10)20)18(21)13-7-11-12(8-14(13)20)16(30-32(25,26)27)5-4-15(11)29-31(22,23)24/h4-5,7-9H,2-3,6H2,1H3,(H,22,23,24)(H,25,26,27)/t20-/m0/s1 |
| InChIKey | MHXLRKPIVSUXMO-FQEVSTJZSA-N |
| XLogP | 2.98 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|