C21H18O10S — CID 75309310
(8,15-dihydroxy-13-methoxy-1-methyl-12,17-dioxo-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2,4,6,8,10,16(20)-hexaen-5-yl) hydrogen sulfate (PubChem CID 75309310) has the molecular formula C21H18O10S and a molecular weight of 462.43 g/mol. Its IUPAC name is (8,15-dihydroxy-13-methoxy-1-methyl-12,17-dioxo-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2,4,6,8,10,16(20)-hexaen-5-yl) hydrogen sulfate.
| Compound Name | (8,15-dihydroxy-13-methoxy-1-methyl-12,17-dioxo-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2,4,6,8,10,16(20)-hexaen-5-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 75309310 |
| Molecular Formula | C21H18O10S |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | (8,15-dihydroxy-13-methoxy-1-methyl-12,17-dioxo-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2,4,6,8,10,16(20)-hexaen-5-yl) hydrogen sulfate |
| SMILES | COC12OC(O)C3=C1C(C)(CCC3=O)c1cc3c(OS(=O)(=O)O)ccc(O)c3cc1C2=O |
| InChI | InChI=1S/C21H18O10S/c1-20-6-5-14(23)16-17(20)21(29-2,30-19(16)25)18(24)11-7-9-10(8-12(11)20)15(4-3-13(9)22)31-32(26,27)28/h3-4,7-8,19,22,25H,5-6H2,1-2H3,(H,26,27,28) |
| InChIKey | VEGXLIPPUQZJQC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|