C21H28F2N4O2 — CID 111007847
2-[[3-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]guanidine (PubChem CID 111007847) has the molecular formula C21H28F2N4O2 and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-[[3-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]guanidine.
| Compound Name | 2-[[3-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]guanidine |
|---|---|
| PubChem CID | 111007847 |
| Molecular Formula | C21H28F2N4O2 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 2-[[3-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(OC(F)F)c1)NCC(c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C21H28F2N4O2/c1-2-24-21(25-14-16-7-5-8-17(13-16)29-20(22)23)26-15-18(19-9-6-12-28-19)27-10-3-4-11-27/h5-9,12-13,18,20H,2-4,10-11,14-15H2,1H3,(H2,24,25,26) |
| InChIKey | KTVZAIDETSJWDG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|