C22H22O6 — CID 11100996
[(1R)-1-[(1R,2R,5S,7R)-2-(4-methoxyphenoxy)-6,8-dioxabicyclo[3.2.1]oct-3-en-7-yl]ethyl] benzoate (PubChem CID 11100996) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is [(1R)-1-[(1R,2R,5S,7R)-2-(4-methoxyphenoxy)-6,8-dioxabicyclo[3.2.1]oct-3-en-7-yl]ethyl] benzoate.
| Compound Name | [(1R)-1-[(1R,2R,5S,7R)-2-(4-methoxyphenoxy)-6,8-dioxabicyclo[3.2.1]oct-3-en-7-yl]ethyl] benzoate |
|---|---|
| PubChem CID | 11100996 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [(1R)-1-[(1R,2R,5S,7R)-2-(4-methoxyphenoxy)-6,8-dioxabicyclo[3.2.1]oct-3-en-7-yl]ethyl] benzoate |
| SMILES | COc1ccc(O[C@@H]2C=C[C@H]3O[C@H]([C@@H](C)OC(=O)c4ccccc4)[C@@H]2O3)cc1 |
| InChI | InChI=1S/C22H22O6/c1-14(25-22(23)15-6-4-3-5-7-15)20-21-18(12-13-19(27-20)28-21)26-17-10-8-16(24-2)9-11-17/h3-14,18-21H,1-2H3/t14-,18-,19+,20-,21-/m1/s1 |
| InChIKey | DAUZJGTYZRXAIP-LNCSSOGTSA-N |
| XLogP | 3.37 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|