C19H20FN3O3S — CID 11101187
[3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] 4-fluorobenzenesulfonate (PubChem CID 11101187) has the molecular formula C19H20FN3O3S and a molecular weight of 389.45 g/mol. Its IUPAC name is [3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] 4-fluorobenzenesulfonate.
| Compound Name | [3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 11101187 |
| Molecular Formula | C19H20FN3O3S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | [3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] 4-fluorobenzenesulfonate |
| SMILES | CN1CCC(c2c[nH]c3ccc(OS(=O)(=O)c4ccc(F)cc4)nc23)CC1 |
| InChI | InChI=1S/C19H20FN3O3S/c1-23-10-8-13(9-11-23)16-12-21-17-6-7-18(22-19(16)17)26-27(24,25)15-4-2-14(20)3-5-15/h2-7,12-13,21H,8-11H2,1H3 |
| InChIKey | FKLMZYPETBQBHD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|