C23H29IN8 — CID 111014314
1-ethyl-3-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111014314) has the molecular formula C23H29IN8 and a molecular weight of 544.45 g/mol. Its IUPAC name is 1-ethyl-3-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111014314 |
| Molecular Formula | C23H29IN8 |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 1-ethyl-3-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCCCc1cn(-c2ccccc2)nc1C.I |
| InChI | InChI=1S/C23H28N8.HI/c1-3-24-23(26-16-22-28-27-21-13-7-8-15-30(21)22)25-14-9-10-19-17-31(29-18(19)2)20-11-5-4-6-12-20;/h4-8,11-13,15,17H,3,9-10,14,16H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | BGOXDWLBIALFCS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|